EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C47H32O7 |
| Net Charge | 0 |
| Average Mass | 708.766 |
| Monoisotopic Mass | 708.21480 |
| SMILES | COc1c(-c2ccccc2)c(O)c(O)c(-c2ccccc2)c1-c1cc2c(oc3c(-c4ccccc4)c(O)c(O)c(-c4ccccc4)c32)c2c(O)cccc12 |
| InChI | InChI=1S/C47H32O7/c1-53-46-36(28-19-10-4-11-20-28)43(51)41(49)34(26-15-6-2-7-16-26)39(46)31-25-32-40-35(27-17-8-3-9-18-27)42(50)44(52)37(29-21-12-5-13-22-29)47(40)54-45(32)38-30(31)23-14-24-33(38)48/h2-25,48-52H,1H3 |
| InChIKey | NGIHJJFCDALUCT-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Allantophomopsis lycopodina (ncbitaxon:334518) | - | PubMed (27731998) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Allantonaphthofuran C (CHEBI:206007) is a diarylheptanoid (CHEBI:78802) |
| IUPAC Name |
|---|
| 5-(4,5-dihydroxy-2-methoxy-3,6-diphenylphenyl)-7,10-diphenylnaphtho[1,2-b][1]benzouran-1,8,9-triol |
| Manual Xrefs | Databases |
|---|---|
| 78435230 | ChemSpider |