EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H7ClN2O4 |
| Net Charge | 0 |
| Average Mass | 194.574 |
| Monoisotopic Mass | 194.00943 |
| SMILES | NC(C(=O)O)[C@H]1ON=C(Cl)[C@H]1O |
| InChI | InChI=1S/C5H7ClN2O4/c6-4-2(9)3(12-8-4)1(7)5(10)11/h1-3,9H,7H2,(H,10,11)/t1?,2-,3+/m0/s1 |
| InChIKey | KUYDILDQEMQBKJ-ZVKPHKKVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces sviceus (ncbitaxon:285530) | - | PubMed (1126872) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| U43795 (CHEBI:205984) is a α-amino acid (CHEBI:33704) |
| IUPAC Name |
|---|
| 2-amino-2-[(4S,5R)-3-chloro-4-hydroxy-4,5-dihydro-1,2-oxazol-5-yl]acetic acid |
| Manual Xrefs | Databases |
|---|---|
| 78437854 | ChemSpider |