EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H8O5 |
| Net Charge | 0 |
| Average Mass | 208.169 |
| Monoisotopic Mass | 208.03717 |
| SMILES | Cc1c(O)c(C=O)c2c(c1O)C(=O)OC2 |
| InChI | InChI=1S/C10H8O5/c1-4-8(12)5(2-11)6-3-15-10(14)7(6)9(4)13/h2,12-13H,3H2,1H3 |
| InChIKey | IOXSICGHBRRIGT-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Talaromyces purpureogenus (ncbitaxon:1266744) | - | PubMed (31833397) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Penibenzone C (CHEBI:205938) is a hydroxybenzoic acid (CHEBI:24676) |
| IUPAC Name |
|---|
| 5,7-dihydroxy-6-methyl-1-oxo-3H-2-benzouran-4-carbaldehyde |