EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H63N3O9 |
| Net Charge | 0 |
| Average Mass | 669.901 |
| Monoisotopic Mass | 669.45643 |
| SMILES | CCC(C)[C@H]1OC(=O)[C@H](CC(C)C)N(C)C(O)[C@@H](C(C)C)OC(=O)[C@H](C(C)C)N(C)C(=O)[C@@H](C(C)C)OC(=O)[C@H](C(C)C)N(C)C1=O |
| InChI | InChI=1S/C35H63N3O9/c1-16-23(12)29-32(41)38(15)26(20(6)7)35(44)46-28(22(10)11)31(40)37(14)25(19(4)5)34(43)45-27(21(8)9)30(39)36(13)24(17-18(2)3)33(42)47-29/h18-30,39H,16-17H2,1-15H3/t23?,24-,25-,26-,27+,28+,29+,30?/m0/s1 |
| InChIKey | UBTDCNJVVJEHMG-WFQSNVLJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Verticillium (ncbitaxon:1036719) | - | PubMed (15712668) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Enniatin O3 (CHEBI:205913) is a cyclodepsipeptide (CHEBI:35213) |
| IUPAC Name |
|---|
| (3S,6R,9S,12R,15S,18R)-12-butan-2-yl-17-hydroxy-4,10,16-trimethyl-15-(2-methylpropyl)-3,6,9,18-tetra(propan-2-yl)-1,7,13-trioxa-4,10,16-triazacyclooctadecane-2,5,8,11,14-pentone |
| Manual Xrefs | Databases |
|---|---|
| 78437851 | ChemSpider |