EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H35NO2 |
| Net Charge | 0 |
| Average Mass | 345.527 |
| Monoisotopic Mass | 345.26678 |
| SMILES | CCC(C)CC(C)/C=C/CCC(=O)C(Cc1ccc(O)cc1)N(C)C |
| InChI | InChI=1S/C22H35NO2/c1-6-17(2)15-18(3)9-7-8-10-22(25)21(23(4)5)16-19-11-13-20(24)14-12-19/h7,9,11-14,17-18,21,24H,6,8,10,15-16H2,1-5H3/b9-7+ |
| InChIKey | PZVTUXNAOUOZMP-VQHVLOKHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pseudallescheria ellipsoidea (ncbitaxon:45271) | - | PubMed (15580957) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| YM-193221 (CHEBI:205911) is a amphetamines (CHEBI:35338) |
| IUPAC Name |
|---|
| (E)-2-(dimethylamino)-1-(4-hydroxyphenyl)-8,10-dimethyldodec-6-en-3-one |
| Manual Xrefs | Databases |
|---|---|
| 7995324 | ChemSpider |