EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H14N2O6S |
| Net Charge | 0 |
| Average Mass | 254.264 |
| Monoisotopic Mass | 254.05726 |
| SMILES | N[C@@H](CCC(=O)NCCS(=O)(=O)O)C(=O)O |
| InChI | InChI=1S/C7H14N2O6S/c8-5(7(11)12)1-2-6(10)9-3-4-16(13,14)15/h5H,1-4,8H2,(H,9,10)(H,11,12)(H,13,14,15)/t5-/m0/s1 |
| InChIKey | WGXUDTHMEITUBO-YFKPBYRVSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Roles: | inorganic acid A Brønsted acid derived from one or more inorganic compounds. Inorganic acids (also known as mineral acids) form hydrons and conjugate base ions when dissolved in water. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). hormone Originally referring to an endogenous compound that is formed in specialized organ or group of cells and carried to another organ or group of cells, in the same organism, upon which it has a specific regulatory function, the term is now commonly used to include non-endogenous, semi-synthetic and fully synthetic analogues of such compounds. mammalian metabolite Any animal metabolite produced during a metabolic reaction in mammals. |
| Applications: | anticonvulsant A drug used to prevent seizures or reduce their severity. anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glutaurine (CHEBI:27694) has functional parent taurine (CHEBI:15891) |
| glutaurine (CHEBI:27694) has role anticonvulsant (CHEBI:35623) |
| glutaurine (CHEBI:27694) has role anxiolytic drug (CHEBI:35474) |
| glutaurine (CHEBI:27694) has role hormone (CHEBI:24621) |
| glutaurine (CHEBI:27694) has role human metabolite (CHEBI:77746) |
| glutaurine (CHEBI:27694) has role mammalian metabolite (CHEBI:75768) |
| glutaurine (CHEBI:27694) has role mouse metabolite (CHEBI:75771) |
| glutaurine (CHEBI:27694) is a L-glutamine derivative (CHEBI:24317) |
| glutaurine (CHEBI:27694) is a dipeptide (CHEBI:46761) |
| glutaurine (CHEBI:27694) is a sulfonic acid (CHEBI:29214) |
| glutaurine (CHEBI:27694) is tautomer of glutaurine zwitterion (CHEBI:140298) |
| Incoming Relation(s) |
| glutaurine zwitterion (CHEBI:140298) is tautomer of glutaurine (CHEBI:27694) |
| IUPAC Name |
|---|
| N-(2-sulfoethyl)-L-glutamine |
| INNs | Source |
|---|---|
| glutaurina | ChemIDplus |
| glutaurine | ChemIDplus |
| glutaurine | WHO MedNet |
| glutaurinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 5-glutamyl-taurine | KEGG COMPOUND |
| 5-L-glutamyl-taurine | KEGG COMPOUND |
| γ-glutamyltaurine | ChemIDplus |
| γ-GT | ChEBI |
| γ-L-glutamyltaurine | ChemIDplus |
| Brand Name | Source |
|---|---|
| Litoralon | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C05844 | KEGG COMPOUND |
| FDB023332 | FooDB |
| Glutaurine | Wikipedia |
| HMDB0004195 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:56488-60-9 | KEGG COMPOUND |
| CAS:56488-60-9 | ChemIDplus |
| Citations |
|---|