EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C47H59NO6 |
| Net Charge | 0 |
| Average Mass | 733.990 |
| Monoisotopic Mass | 733.43424 |
| SMILES | CC(C)=CCOC1=CC(=O)c2c(O)c3c(c4c(O)cc(C)c1c24)O[C@H]1C=C2C(=CC[C@]4(C)[C@@H]([C@H](C)/C=C/[C@H](C)C(C)C)CC[C@@H]24)[C@@]2(C)CC[C@H](O)C[C@]12N3 |
| InChI | InChI=1S/C47H59NO6/c1-24(2)16-19-53-36-22-35(51)39-41-38(36)28(7)20-34(50)40(41)44-42(43(39)52)48-47-23-29(49)14-18-46(47,9)33-15-17-45(8)31(27(6)11-10-26(5)25(3)4)12-13-32(45)30(33)21-37(47)54-44/h10-11,15-16,20-22,25-27,29,31-32,37,48-50,52H,12-14,17-19,23H2,1-9H3/b11-10+/t26-,27+,29-,31+,32-,37-,45+,46+,47-/m0/s1 |
| InChIKey | NOTBRCBKRZOPMH-PVXFBCSCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Neosetophoma cerealis (ncbitaxon:2718965) | - | PubMed (26840293) |
| Roles Classification |
|---|
| Biological Role: | fat-soluble vitamin (role) Any vitamin that dissolves in fats and are stored in body tissues. Unlike the water-soluble vitamins, they are stored in the body for long periods of time and generally pose a greater risk for toxicity when consumed in excess. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Conio-azasterol (CHEBI:205897) is a vitamin D (CHEBI:27300) |
| IUPAC Name |
|---|
| (4S,7R,10R,11R,15R,18S,20R)-10-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-18,23,31-trihydroxy-11,15,29-trimethyl-27-(3-methylbut-2-enoxy)-3-oxa-21-azaoctacyclo[22.7.1.02,22.04,20.06,14.07,11.015,20.028,32]dotriaconta-1(31),2(22),5,13,23,26,28(32),29-octaen-25-one |