EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H30N2O6S2 |
| Net Charge | 0 |
| Average Mass | 566.701 |
| Monoisotopic Mass | 566.15453 |
| SMILES | COc1ccc(C(=O)O[C@H]2C=CC=C3C[C@@]4(SC)C(=O)N(C)[C@](Cc5ccccc5)(SC)C(=O)N4[C@@H]32)cc1O |
| InChI | InChI=1S/C29H30N2O6S2/c1-30-26(34)29(39-4)17-20-11-8-12-23(37-25(33)19-13-14-22(36-2)21(32)15-19)24(20)31(29)27(35)28(30,38-3)16-18-9-6-5-7-10-18/h5-15,23-24,32H,16-17H2,1-4H3/t23-,24-,28+,29+/m0/s1 |
| InChIKey | LQJLELKBOGPILP-OMICENBGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Podospora australis (ncbitaxon:1536484) | - | PubMed (27557418) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Emestrin K (CHEBI:205868) is a methoxybenzoic acid (CHEBI:25238) |
| IUPAC Name |
|---|
| [(3R,5aS,6S,10aR)-3-benzyl-2-methyl-3,10a-bis(methylsulanyl)-1,4-dioxo-6,10-dihydro-5aH-pyrazino[1,2-a]indol-6-yl] 3-hydroxy-4-methoxybenzoate |
| Manual Xrefs | Databases |
|---|---|
| 76775327 | ChemSpider |