EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H24N2O7S2 |
| Net Charge | 0 |
| Average Mass | 552.630 |
| Monoisotopic Mass | 552.10249 |
| SMILES | COc1ccc(C(=O)O[C@H]2C=COC=C3C[C@]45SS[C@](Cc6ccccc6)(C(=O)N4[C@@H]32)N(C)C5=O)cc1O |
| InChI | InChI=1S/C27H24N2O7S2/c1-28-24(32)27-14-18-15-35-11-10-21(36-23(31)17-8-9-20(34-2)19(30)12-17)22(18)29(27)25(33)26(28,37-38-27)13-16-6-4-3-5-7-16/h3-12,15,21-22,30H,13-14H2,1-2H3/t21-,22-,26+,27+/m0/s1 |
| InChIKey | BLIVHWUOHVIKNC-DOQQYFFYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Podospora australis (ncbitaxon:1536484) | - | PubMed (27557418) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Emestrin J (CHEBI:205862) is a methoxybenzoic acid (CHEBI:25238) |
| IUPAC Name |
|---|
| [(1R,8S,9S,12R)-12-benzyl-16-methyl-11,15-dioxo-5-oxa-13,14-dithia-10,16-diazatetracyclo[10.2.2.01,10.03,9]hexadeca-3,6-dien-8-yl] 3-hydroxy-4-methoxybenzoate |
| Manual Xrefs | Databases |
|---|---|
| 76781749 | ChemSpider |