EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H30N2O7S2 |
| Net Charge | 0 |
| Average Mass | 582.700 |
| Monoisotopic Mass | 582.14944 |
| SMILES | COc1ccc(C(=O)O[C@H]2C=COC=C3C[C@@]4(SC)C(=O)N(C)[C@](Cc5ccccc5)(SC)C(=O)N4[C@@H]32)cc1O |
| InChI | InChI=1S/C29H30N2O7S2/c1-30-26(34)29(40-4)16-20-17-37-13-12-23(38-25(33)19-10-11-22(36-2)21(32)14-19)24(20)31(29)27(35)28(30,39-3)15-18-8-6-5-7-9-18/h5-14,17,23-24,32H,15-16H2,1-4H3/t23-,24-,28+,29+/m0/s1 |
| InChIKey | DCDQBIQRLOCMAZ-OMICENBGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Podospora australis (ncbitaxon:1536484) | - | PubMed (27557418) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Emestrin I (CHEBI:205854) is a methoxybenzoic acid (CHEBI:25238) |
| IUPAC Name |
|---|
| [(1S,4R,7R,14S)-4-benzyl-5-methyl-4,7-bis(methylsulanyl)-3,6-dioxo-11-oxa-2,5-diazatricyclo[7.5.0.02,7]tetradeca-9,12-dien-14-yl] 3-hydroxy-4-methoxybenzoate |
| Manual Xrefs | Databases |
|---|---|
| 76777811 | ChemSpider |