EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H15NO6 |
| Net Charge | 0 |
| Average Mass | 269.253 |
| Monoisotopic Mass | 269.08994 |
| SMILES | CCOC(=O)[C@H](CO)NC(=O)c1cccc(O)c1O |
| InChI | InChI=1S/C12H15NO6/c1-2-19-12(18)8(6-14)13-11(17)7-4-3-5-9(15)10(7)16/h3-5,8,14-16H,2,6H2,1H3,(H,13,17)/t8-/m0/s1 |
| InChIKey | ZNAULGVROLOSBS-QMMMGPOBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (24666327) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Axinelline A (CHEBI:205835) is a N-acylglycine (CHEBI:16180) |
| IUPAC Name |
|---|
| ethyl (2S)-2-[(2,3-dihydroxybenzoyl)amino]-3-hydroxypropanoate |
| Manual Xrefs | Databases |
|---|---|
| 34981160 | ChemSpider |