EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H14O6 |
| Net Charge | 0 |
| Average Mass | 302.282 |
| Monoisotopic Mass | 302.07904 |
| SMILES | COc1cc(O)c2c(O)c(OC)c(O)c3c2c1C(C)=CC3=O |
| InChI | InChI=1S/C16H14O6/c1-6-4-7(17)11-13-10(6)9(21-2)5-8(18)12(13)15(20)16(22-3)14(11)19/h4-5,18-20H,1-3H3 |
| InChIKey | XUQNUNNKJDRYJL-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Myeloconis erumpens (ncbitaxon:1567532) | - | DOI (10.1071/ch00139) |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Myeloconone A2 (CHEBI:205814) is a ortho- and peri-fused tricyclic hydrocarbon (CHEBI:51120) |
| IUPAC Name |
|---|
| 6,7,9-trihydroxy-4,8-dimethoxy-3-methylphenalen-1-one |
| Manual Xrefs | Databases |
|---|---|
| 78435364 | ChemSpider |