EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C41H60N4O8 |
| Net Charge | 0 |
| Average Mass | 736.951 |
| Monoisotopic Mass | 736.44111 |
| SMILES | C#CCCC[C@@H]1OC(=O)[C@H](C(C)C)N(C)C(=O)[C@@H]2CCCN2C(=O)[C@H](Cc2ccccc2)OC(=O)[C@H]([C@@H](C)CC)N(C)C(=O)[C@H](C(C)C)NC(=O)C1C |
| InChI | InChI=1S/C41H60N4O8/c1-11-13-15-22-31-28(8)36(46)42-33(25(3)4)39(49)44(10)35(27(7)12-2)41(51)53-32(24-29-19-16-14-17-20-29)38(48)45-23-18-21-30(45)37(47)43(9)34(26(5)6)40(50)52-31/h1,14,16-17,19-20,25-28,30-35H,12-13,15,18,21-24H2,2-10H3,(H,42,46)/t27-,28?,30-,31-,32-,33-,34-,35-/m0/s1 |
| InChIKey | QEERUAVEBIAUIV-QUIBGUPGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lyngbya majuscula (ncbitaxon:158786) | - | PubMed (19093843) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Hantupeptin A (CHEBI:205784) is a cyclodepsipeptide (CHEBI:35213) |
| IUPAC Name |
|---|
| (3S,6S,9S,13S,16S,19S)-3-benzyl-6-[(2S)-butan-2-yl]-7,12,17-trimethyl-13-pent-4-ynyl-9,16-di(propan-2-yl)-4,14-dioxa-1,7,10,17-tetrazabicyclo[17.3.0]docosane-2,5,8,11,15,18-hexone |
| Manual Xrefs | Databases |
|---|---|
| 24622032 | ChemSpider |