EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H25NO8 |
| Net Charge | 0 |
| Average Mass | 443.452 |
| Monoisotopic Mass | 443.15802 |
| SMILES | CN[C@@H]1C[C@H](c2ccc3c(c2O)C(=O)C2=C(C3=O)[C@H]3OC(=O)C[C@H]3O[C@@H]2C)O[C@H](C)[C@H]1O |
| InChI | InChI=1S/C23H25NO8/c1-8-16-18(23-14(30-8)7-15(25)32-23)21(28)11-5-4-10(20(27)17(11)22(16)29)13-6-12(24-3)19(26)9(2)31-13/h4-5,8-9,12-14,19,23-24,26-27H,6-7H2,1-3H3/t8-,9-,12-,13-,14-,19-,23+/m1/s1 |
| InChIKey | NVDVGEYHDRXWNO-LWRGVASRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (29947258) |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3′-N-methyl-medermycin (CHEBI:205781) is a benzoisochromanequinone (CHEBI:48129) |
| IUPAC Name |
|---|
| (11R,15R,17R)-4-hydroxy-5-[(2R,4R,5S,6R)-5-hydroxy-6-methyl-4-(methylamino)oxan-2-yl]-17-methyl-12,16-dioxatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),3(8),4,6-tetraene-2,9,13-trione |