EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H31NO8 |
| Net Charge | 0 |
| Average Mass | 425.478 |
| Monoisotopic Mass | 425.20497 |
| SMILES | O=C(O)CCCCCCCC/C=C/C(=O)N[C@H]1C[C@@]2(O)C(=O)[C@H]([C@H](O)[C@@H]3O[C@@H]32)[C@H]1O |
| InChI | InChI=1S/C21H31NO8/c23-13(9-7-5-3-1-2-4-6-8-10-14(24)25)22-12-11-21(29)19(28)15(16(12)26)17(27)18-20(21)30-18/h7,9,12,15-18,20,26-27,29H,1-6,8,10-11H2,(H,22,23)(H,24,25)/b9-7+/t12-,15-,16-,17-,18-,20-,21+/m0/s1 |
| InChIKey | GCOQLRRFBKJAPF-DBGSMAKUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Isaria (ncbitaxon:72232) | - | PubMed (17822299) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Isariotin B (CHEBI:205760) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| (E)-12-oxo-12-[[(1S,2S,4S,5S,6S,7R,8S)-1,5,7-trihydroxy-10-oxo-3-oxatricyclo[4.3.1.02,4]decan-8-yl]amino]dodec-10-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| 23311651 | ChemSpider |