EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H18O5 |
| Net Charge | 0 |
| Average Mass | 266.293 |
| Monoisotopic Mass | 266.11542 |
| SMILES | CCC[C@@H](O)C[C@@H]1Cc2cc(O)cc(O)c2C(=O)O1 |
| InChI | InChI=1S/C14H18O5/c1-2-3-9(15)6-11-5-8-4-10(16)7-12(17)13(8)14(18)19-11/h4,7,9,11,15-17H,2-3,5-6H2,1H3/t9-,11+/m1/s1 |
| InChIKey | GUPPCWWAWQRGBV-KOLCDFICSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Plenodomus lingam (ncbitaxon:5022) | - | PubMed (29966449) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Maculansline C (CHEBI:205688) is a hydroxybenzoic acid (CHEBI:24676) |
| IUPAC Name |
|---|
| (3S)-6,8-dihydroxy-3-[(2R)-2-hydroxypentyl]-3,4-dihydroisochromen-1-one |