EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H30N2O8 |
| Net Charge | 0 |
| Average Mass | 450.488 |
| Monoisotopic Mass | 450.20022 |
| SMILES | CCC(C)CC1C(=O)OC(C)C(NC(=O)c2cccc(NC=O)c2O)C(=O)OC(C)C1O |
| InChI | InChI=1S/C22H30N2O8/c1-5-11(2)9-15-18(26)13(4)32-22(30)17(12(3)31-21(15)29)24-20(28)14-7-6-8-16(19(14)27)23-10-25/h6-8,10-13,15,17-18,26-27H,5,9H2,1-4H3,(H,23,25)(H,24,28) |
| InChIKey | UXCOEHGXGSWISO-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (8468237) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Urauchimycin A (CHEBI:205683) is a amidobenzoic acid (CHEBI:48470) |
| IUPAC Name |
|---|
| 3-ormamido-2-hydroxy-N-[7-hydroxy-2,6-dimethyl-8-(2-methylbutyl)-4,9-dioxo-1,5-dioxonan-3-yl]benzamide |
| Manual Xrefs | Databases |
|---|---|
| 8519205 | ChemSpider |