EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H34O3 |
| Net Charge | 0 |
| Average Mass | 358.522 |
| Monoisotopic Mass | 358.25079 |
| SMILES | COCc1cc(O)c2c(c1O)[C@@]1(C)CC[C@H]3C(C)(C)CCC[C@]3(C)[C@H]1C2 |
| InChI | InChI=1S/C23H34O3/c1-21(2)8-6-9-22(3)17(21)7-10-23(4)18(22)12-15-16(24)11-14(13-26-5)20(25)19(15)23/h11,17-18,24-25H,6-10,12-13H2,1-5H3/t17-,18+,22-,23-/m0/s1 |
| InChIKey | APGZBIKZXBYIEJ-WKZKVMAPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Dasyscyphus (ncbitaxon:318839) | - | DOI (10.1016/j.tet.2005.11.041) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Dasyscyphin B (CHEBI:205659) is a fluorenes (CHEBI:24059) |
| IUPAC Name |
|---|
| (4aS,6aS,11aR,11bS)-8-(methoxymethyl)-4,4,6a,11b-tetramethyl-1,2,3,4a,5,6,11,11a-octahydrobenzo[a]luorene-7,10-diol |
| Manual Xrefs | Databases |
|---|---|
| 9690786 | ChemSpider |