EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24O3 |
| Net Charge | 0 |
| Average Mass | 252.354 |
| Monoisotopic Mass | 252.17254 |
| SMILES | C=C(/C=C/[C@@H](CCC(C)=O)C(C)C)CCC(=O)O |
| InChI | InChI=1S/C15H24O3/c1-11(2)14(9-7-13(4)16)8-5-12(3)6-10-15(17)18/h5,8,11,14H,3,6-7,9-10H2,1-2,4H3,(H,17,18)/b8-5+/t14-/m0/s1 |
| InChIKey | YHPXMAOELHYYDQ-GPAKFWEMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Fusarium tricinctum (ncbitaxon:61284) | - | PubMed (20221941) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Tricinonoic acid (CHEBI:205574) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| (E)-4-methylidene-10-oxo-7-propan-2-ylundec-5-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| 65018126 | ChemSpider |