EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H37NO3S |
| Net Charge | 0 |
| Average Mass | 431.642 |
| Monoisotopic Mass | 431.24942 |
| SMILES | CS[C@@H]1CC(=O)CCC/C(C)=C/[C@H]2C=C(C)[C@@H](C)[C@H]3[C@H](CC(C)C)NC(=O)[C@]32C1=O |
| InChI | InChI=1S/C25H37NO3S/c1-14(2)10-20-22-17(5)16(4)12-18-11-15(3)8-7-9-19(27)13-21(30-6)23(28)25(18,22)24(29)26-20/h11-12,14,17-18,20-22H,7-10,13H2,1-6H3,(H,26,29)/b15-11+/t17-,18+,20+,21-,22+,25+/m1/s1 |
| InChIKey | SKBNNAZECLMWGM-URDOSIFYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillusspecies (ncbitaxon:5065) | - | PubMed (25272329) |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Aspochalasin V (CHEBI:205550) has role fungal metabolite (CHEBI:76946) |
| Aspochalasin V (CHEBI:205550) is a cytochalasin (CHEBI:23528) |
| IUPAC Name |
|---|
| (1S,3R,9E,11S,14S,15R,16S)-9,13,14-trimethyl-16-(2-methylpropyl)-3-methylsulanyl-17-azatricyclo[9.7.0.01,15]octadeca-9,12-diene-2,5,18-trione |
| Manual Xrefs | Databases |
|---|---|
| 34981319 | ChemSpider |