EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C37H41NO17 |
| Net Charge | 0 |
| Average Mass | 771.725 |
| Monoisotopic Mass | 771.23745 |
| SMILES | COc1cc(C)c(C(=O)Oc2cc(C)c(C(=O)Oc3cc(C)c(C(=O)N[C@@H](C)C(=O)O)c(O)c3)c(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3OC(C)=O)c2)c(OC)c1 |
| InChI | InChI=1S/C37H41NO17/c1-15-9-21(11-23(41)27(15)33(44)38-18(4)34(45)46)52-36(48)29-17(3)10-22(53-35(47)28-16(2)8-20(49-6)12-24(28)50-7)13-25(29)54-37-32(51-19(5)40)31(43)30(42)26(14-39)55-37/h8-13,18,26,30-32,37,39,41-43H,14H2,1-7H3,(H,38,44)(H,45,46)/t18-,26+,30+,31-,32+,37+/m0/s1 |
| InChIKey | JBSTZXRMJYWRCO-UAFDTWFTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Humicola (ncbitaxon:5526) | - | PubMed (19942946) |
| Roles Classification |
|---|
| Application: | astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Amidepsine H (CHEBI:205538) is a tannin (CHEBI:26848) |
| IUPAC Name |
|---|
| (2S)-2-[[4-[2-[(2S,3R,4S,5S,6R)-3-acetyloxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4-(2,4-dimethoxy-6-methylbenzoyl)oxy-6-methylbenzoyl]oxy-2-hydroxy-6-methylbenzoyl]amino]propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78437298 | ChemSpider |