EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H11BrN2O6 |
| Net Charge | 0 |
| Average Mass | 323.099 |
| Monoisotopic Mass | 321.98005 |
| SMILES | O=c1nc(=O)n([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)cc1Br |
| InChI | InChI=1S/C9H11BrN2O6/c10-3-1-12(9(17)11-7(3)16)8-6(15)5(14)4(2-13)18-8/h1,4-6,8,13-15H,2H2,(H,11,16,17)/t4-,5-,6-,8-/m1/s1 |
| InChIKey | AGFIRQJZCNVMCW-UAKXSSHOSA-N |
| Roles Classification |
|---|
| Biological Role: | mutagen An agent that increases the frequency of mutations above the normal background level, usually by interacting directly with DNA and causing it damage, including base substitution. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-bromouridine (CHEBI:20553) has role mutagen (CHEBI:25435) |
| 5-bromouridine (CHEBI:20553) is a uridines (CHEBI:27242) |
| IUPAC Name |
|---|
| 5-bromouridine |
| Synonyms | Source |
|---|---|
| 5-bromouridine | ChEBI |
| 5-bromo-1-β-D-ribofuranosylpyrimidine-2,4(1H,3H)-dione | ChEBI |
| 1-β-ribofuranosyl-5-bromo-uracil | ChemIDplus |
| BrU | ChEBI |
| UniProt Name | Source |
|---|---|
| 5-bromouridine | UniProt |
| Registry Numbers | Sources |
|---|---|
| Gmelin:723432 | Gmelin |
| Beilstein:33664 | Beilstein |
| CAS:957-75-5 | ChemIDplus |
| Citations |
|---|