EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H22O10 |
| Net Charge | 0 |
| Average Mass | 482.441 |
| Monoisotopic Mass | 482.12130 |
| SMILES | [H][C@]1(c2ccc(O)c(OC)c2)Oc2ccc([C@@]3([H])Oc4cc(O)cc(O)c4C(=O)[C@@H]3O)cc2O[C@@H]1CO |
| InChI | InChI=1S/C25H22O10/c1-32-17-6-11(2-4-14(17)28)24-20(10-26)33-18-7-12(3-5-16(18)34-24)25-23(31)22(30)21-15(29)8-13(27)9-19(21)35-25/h2-9,20,23-29,31H,10H2,1H3/t20-,23+,24-,25-/m1/s1 |
| InChIKey | FDQAOULAVFHKBX-HKTJVKLFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus iizukae (ncbitaxon:41901) | - | PubMed (24456525) | |
| Silybum marianum (ncbitaxon:92921) | - | PubMed (17764149) |
| Roles Classification |
|---|
| Biological Roles: | PPARgamma agonist A PPAR modulator which activates the peroxisome proliferator-activated receptor-γ. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isosilybin A (CHEBI:205528) has role Aspergillus metabolite (CHEBI:76956) |
| isosilybin A (CHEBI:205528) has role apoptosis inducer (CHEBI:68495) |
| isosilybin A (CHEBI:205528) has role plant metabolite (CHEBI:76924) |
| isosilybin A (CHEBI:205528) has role PPARγ agonist (CHEBI:71554) |
| isosilybin A (CHEBI:205528) is a flavonolignan (CHEBI:72709) |
| IUPAC Name |
|---|
| (2R,3R)-3,5,7-trihydroxy-2-[(2R,3R)-2-(4-hydroxy-3-methoxyphenyl)-3-(hydroxymethyl)-2,3-dihydro-1,4-benzodioxin-6-yl]-2,3-dihydro-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| (2R,3R)-3,5,7-trihydroxy-2-[(2R,3R)-2-(4-hydroxy-3-methoxyphenyl)-3-(hydroxymethyl)-2,3-dihydro-1,4-benzodioxin-6-yl]-2,3-dihydro-4H-1-benzopyran-4-one | IUPAC |
| (2R,3R)-3,5,7-trihydroxy-2-[(2R,3R)-2-(4-hydroxy-3-methoxyphenyl)-3-(hydroxymethyl)-2,3-dihydro-1,4-benzodioxin-6-yl]-2,3-dihydrochromen-4-one | SUBMITTER |
| (+)-isosilybin A | KNApSAcK |
| Manual Xrefs | Databases |
|---|---|
| 9235077 | ChemSpider |
| C00039453 | KNApSAcK |
| LMPK12140713 | LIPID MAPS |
| Citations |
|---|