EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H3BrN2O2 |
| Net Charge | 0 |
| Average Mass | 190.984 |
| Monoisotopic Mass | 189.93779 |
| SMILES | O=c1ncc(Br)c(=O)n1 |
| InChI | InChI=1S/C4H3BrN2O2/c5-2-1-6-4(9)7-3(2)8/h1H,(H2,6,7,8,9) |
| InChIKey | LQLQRFGHAALLLE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | mutagen An agent that increases the frequency of mutations above the normal background level, usually by interacting directly with DNA and causing it damage, including base substitution. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-bromouracil (CHEBI:20552) has functional parent uracil (CHEBI:17568) |
| 5-bromouracil (CHEBI:20552) has role mutagen (CHEBI:25435) |
| 5-bromouracil (CHEBI:20552) is a nucleobase analogue (CHEBI:67142) |
| 5-bromouracil (CHEBI:20552) is a pyrimidines (CHEBI:39447) |
| IUPAC Name |
|---|
| 5-bromopyrimidine-2,4(1H,3H)-dione |
| Synonyms | Source |
|---|---|
| 1,2,3,4-tetrahydro-5-bromo-2,4-pyrimidinedione | NIST Chemistry WebBook |
| 5-bromo-2,4(1H,3H)-pyrimidinedione | NIST Chemistry WebBook |
| 5-BrU | ChemIDplus |
| 5-BU | ChemIDplus |
| bromouracil | ChemIDplus |
| Citations |
|---|