EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H46N6O8 |
| Net Charge | 0 |
| Average Mass | 690.798 |
| Monoisotopic Mass | 690.33771 |
| SMILES | C/C=C1\NC(=O)[C@H](C)NC(=O)[C@H](C(C)C)NC(=O)[C@H](NC(=O)[C@H](Cc2ccccc2)NC(=O)[C@@H](Cc2ccccc2)NC(C)=O)[C@@H](C)OC1=O |
| InChI | InChI=1S/C36H46N6O8/c1-7-26-36(49)50-22(5)30(35(48)41-29(20(2)3)34(47)37-21(4)31(44)39-26)42-33(46)28(19-25-16-12-9-13-17-25)40-32(45)27(38-23(6)43)18-24-14-10-8-11-15-24/h7-17,20-22,27-30H,18-19H2,1-6H3,(H,37,47)(H,38,43)(H,39,44)(H,40,45)(H,41,48)(H,42,46)/b26-7-/t21-,22+,27+,28-,29-,30+/m0/s1 |
| InChIKey | NUKXVWPUFGMEDK-MXUYVNIMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomycesspecies CN48 (ncbitaxon:1049553) | - | PubMed (21524089) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Nobilamide D (CHEBI:205492) is a cyclodepsipeptide (CHEBI:35213) |
| IUPAC Name |
|---|
| (2R)-2-acetamido-N-[(2S)-1-[[(3Z,6S,9S,12R,13R)-3-ethylidene-6,13-dimethyl-2,5,8,11-tetraoxo-9-propan-2-yl-1-oxa-4,7,10-triazacyclotridec-12-yl]amino]-1-oxo-3-phenylpropan-2-yl]-3-phenylpropanamide |
| Manual Xrefs | Databases |
|---|---|
| 27025556 | ChemSpider |