EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H46O4 |
| Net Charge | 0 |
| Average Mass | 470.694 |
| Monoisotopic Mass | 470.33961 |
| SMILES | CC1=CC[C@H]([C@@H](C)[C@H]2CC[C@@]3(C)C4=C(CC[C@]23C)[C@@]2(C)[C@H](O)C[C@H](O)C(C)(C)[C@@H]2CC4)OC1=O |
| InChI | InChI=1S/C30H46O4/c1-17-8-10-22(34-26(17)33)18(2)19-12-14-29(6)20-9-11-23-27(3,4)24(31)16-25(32)30(23,7)21(20)13-15-28(19,29)5/h8,18-19,22-25,31-32H,9-16H2,1-7H3/t18-,19+,22+,23-,24-,25+,28+,29-,30+/m0/s1 |
| InChIKey | HDQNMUHADJVPDL-QOSYOKLWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ganoderma (ncbitaxon:5314) | - | PubMed (18451550) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Colobetaolactone II (CHEBI:205484) is a withanolide (CHEBI:74716) |
| IUPAC Name |
|---|
| (2R)-2-[(1S)-1-[(1R,3S,5S,10S,13R,14R,17R)-1,3-dihydroxy-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]ethyl]-5-methyl-2,3-dihydropyran-6-one |
| Manual Xrefs | Databases |
|---|---|
| 78437294 | ChemSpider |