EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H21N3O6 |
| Net Charge | 0 |
| Average Mass | 363.370 |
| Monoisotopic Mass | 363.14304 |
| SMILES | O=CNCCCCC(NC(=O)C1COC(c2ccccc2O)=N1)C(=O)O |
| InChI | InChI=1S/C17H21N3O6/c21-10-18-8-4-3-6-12(17(24)25)19-15(23)13-9-26-16(20-13)11-5-1-2-7-14(11)22/h1-2,5,7,10,12-13,22H,3-4,6,8-9H2,(H,18,21)(H,19,23)(H,24,25) |
| InChIKey | AORLEWGZMFBGQF-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Nocardia (ncbitaxon:1817) | - | PubMed (16915823) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Transvalencin Z (CHEBI:205432) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| 6-ormamido-2-[[2-(2-hydroxyphenyl)-4,5-dihydro-1,3-oxazole-4-carbonyl]amino]hexanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 28283528 | ChemSpider |