EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H24O9 |
| Net Charge | 0 |
| Average Mass | 360.359 |
| Monoisotopic Mass | 360.14203 |
| SMILES | COc1cc(C)c(C(=O)OC[C@H](O)[C@H](O)[C@@H](O)[C@@H](O)CO)c(OC)c1 |
| InChI | InChI=1S/C16H24O9/c1-8-4-9(23-2)5-12(24-3)13(8)16(22)25-7-11(19)15(21)14(20)10(18)6-17/h4-5,10-11,14-15,17-21H,6-7H2,1-3H3/t10-,11-,14-,15-/m0/s1 |
| InChIKey | GHYNYYCIHYFSPW-GVARAGBVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Eurotium (ncbitaxon:28569) | - | DOI (10.1002/hlca.201300358) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cristatumside A (CHEBI:205428) is a methoxybenzoic acid (CHEBI:25238) |
| IUPAC Name |
|---|
| [(2S,3S,4S,5S)-2,3,4,5,6-pentahydroxyhexyl] 2,4-dimethoxy-6-methylbenzoate |
| Manual Xrefs | Databases |
|---|---|
| 34981921 | ChemSpider |