EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H19N7O5 |
| Net Charge | 0 |
| Average Mass | 425.405 |
| Monoisotopic Mass | 425.14477 |
| SMILES | C[C@H](NC(=O)c1cnc2c(n1)c(=O)n(C)c(=O)n2C)C(=O)Nc1ccccc1C(N)=O |
| InChI | InChI=1S/C19H19N7O5/c1-9(16(28)24-11-7-5-4-6-10(11)14(20)27)22-17(29)12-8-21-15-13(23-12)18(30)26(3)19(31)25(15)2/h4-9H,1-3H3,(H2,20,27)(H,22,29)(H,24,28)/t9-/m0/s1 |
| InChIKey | IQOHPUBEUCHHAI-VIFPVBQESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus (ncbitaxon:5052) | - | PubMed (25001296) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Penilumamide D (CHEBI:205403) is a amidobenzoic acid (CHEBI:48470) |
| IUPAC Name |
|---|
| N-[(2S)-1-(2-carbamoylanilino)-1-oxopropan-2-yl]-1,3-dimethyl-2,4-dioxopteridine-6-carboxamide |
| Manual Xrefs | Databases |
|---|---|
| 34981999 | ChemSpider |