EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H51N9O8 |
| Net Charge | 0 |
| Average Mass | 713.837 |
| Monoisotopic Mass | 713.38606 |
| SMILES | CC/C=C/CC1NC(=O)[C@H](C)NC(=O)[C@H](CC(=O)O)NC(=O)C(Cc2ccccc2)N(C)C(=O)[C@H](CCCN=C(N)NC(=O)NC)NC(=O)C1C |
| InChI | InChI=1S/C34H51N9O8/c1-6-7-9-15-23-20(2)28(46)40-24(16-12-17-37-33(35)42-34(51)36-4)32(50)43(5)26(18-22-13-10-8-11-14-22)31(49)41-25(19-27(44)45)30(48)38-21(3)29(47)39-23/h7-11,13-14,20-21,23-26H,6,12,15-19H2,1-5H3,(H,38,48)(H,39,47)(H,40,46)(H,41,49)(H,44,45)(H4,35,36,37,42,51)/b9-7+/t20?,21-,23?,24-,25-,26?/m0/s1 |
| InChIKey | OPFHYLNKVKPGNV-HUUBDTTPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Nostocspecies (ncbitaxon:1180) | - | DOI (10.1016/j.tet.2004.11.016) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Banyasin A (CHEBI:205399) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| 2-[(3S,6S,12S)-12-[3-[[amino-(methylcarbamoylamino)methylidene]amino]propyl]-9-benzyl-3,10,15-trimethyl-2,5,8,11,14-pentaoxo-16-[(E)-pent-2-enyl]-1,4,7,10,13-pentazacyclohexadec-6-yl]acetic acid |
| Manual Xrefs | Databases |
|---|---|
| 78445147 | ChemSpider |