EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C45H71N5O9 |
| Net Charge | 0 |
| Average Mass | 826.089 |
| Monoisotopic Mass | 825.52518 |
| SMILES | CCCCCCCCCCCCC/C=C\C(=O)N(O)CCCC[C@H](NC(=O)[C@H]1N=C(c2ccccc2)O[C@@H]1C)C(=O)O[C@H](CC)[C@H](C)C(=O)N[C@H]1CCCCN(O)C1=O |
| InChI | InChI=1S/C45H71N5O9/c1-5-7-8-9-10-11-12-13-14-15-16-17-21-30-39(51)49(56)31-24-23-29-37(47-42(53)40-34(4)58-43(48-40)35-26-19-18-20-27-35)45(55)59-38(6-2)33(3)41(52)46-36-28-22-25-32-50(57)44(36)54/h18-21,26-27,30,33-34,36-38,40,56-57H,5-17,22-25,28-29,31-32H2,1-4H3,(H,46,52)(H,47,53)/b30-21-/t33-,34+,36-,37-,38+,40-/m0/s1 |
| InChIKey | WWLHPLBUIBTYIH-LIPSAQSSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mycobacterium avium subsp. paratuberculosis (ncbitaxon:1770) | - | DOI (10.1016/s0040-4039(01)00531-7) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Mycobactin J (CHEBI:205364) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| [(2S,3R)-1-[[(3S)-1-hydroxy-2-oxoazepan-3-yl]amino]-2-methyl-1-oxopentan-3-yl] (2S)-6-[[(Z)-hexadec-2-enoyl]-hydroxyamino]-2-[[(4S,5R)-5-methyl-2-phenyl-4,5-dihydro-1,3-oxazole-4-carbonyl]amino]hexanoate |
| Manual Xrefs | Databases |
|---|---|
| 78442607 | ChemSpider |