EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H42O9 |
| Net Charge | 0 |
| Average Mass | 498.613 |
| Monoisotopic Mass | 498.28288 |
| SMILES | C/C(=C\C(=O)OCCCCCCCCC(=O)O)C[C@@H]1OC[C@H](C[C@@H]2O[C@H]2[C@@H](C)[C@H](C)O)C(=O)[C@H]1O |
| InChI | InChI=1S/C26H42O9/c1-16(13-23(30)33-11-9-7-5-4-6-8-10-22(28)29)12-20-25(32)24(31)19(15-34-20)14-21-26(35-21)17(2)18(3)27/h13,17-21,25-27,32H,4-12,14-15H2,1-3H3,(H,28,29)/b16-13+/t17-,18-,19-,20-,21-,25-,26-/m0/s1 |
| InChIKey | KYBYRSYYFWFXDN-XVSJZSRMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pseudomonas fluorescens (ncbitaxon:294) | - | DOI (10.1016/j.tet.2011.05.021) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Mupirocin F (CHEBI:205355) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| 9-[(E)-4-[(2S,3S,5S)-3-hydroxy-5-[[(2S,3S)-3-[(2S,3S)-3-hydroxybutan-2-yl]oxiran-2-yl]methyl]-4-oxooxan-2-yl]-3-methylbut-2-enoyl]oxynonanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 28288855 | ChemSpider |