EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H14O6 |
| Net Charge | 0 |
| Average Mass | 254.238 |
| Monoisotopic Mass | 254.07904 |
| SMILES | COC1(C)OC(=O)c2c(cc(O)c(C)c2O)C1O |
| InChI | InChI=1S/C12H14O6/c1-5-7(13)4-6-8(9(5)14)11(16)18-12(2,17-3)10(6)15/h4,10,13-15H,1-3H3 |
| InChIKey | JFNJJCWJWUOTOS-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus (ncbitaxon:5052) | - | PubMed (25996099) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4,6,8-trihydroxy-3-methoxy-3,7-dimethyl-4H-isochromen-1-one (CHEBI:205345) is a hydroxybenzoic acid (CHEBI:24676) |
| IUPAC Name |
|---|
| 4,6,8-trihydroxy-3-methoxy-3,7-dimethyl-4H-isochromen-1-one |
| Manual Xrefs | Databases |
|---|---|
| 35516990 | ChemSpider |