EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H25NO5 |
| Net Charge | 0 |
| Average Mass | 347.411 |
| Monoisotopic Mass | 347.17327 |
| SMILES | CC(/C=C/C(=O)NC(CO)Cc1ccc(O)cc1)=C\C(C)CC(=O)O |
| InChI | InChI=1S/C19H25NO5/c1-13(9-14(2)10-19(24)25)3-8-18(23)20-16(12-21)11-15-4-6-17(22)7-5-15/h3-9,14,16,21-22H,10-12H2,1-2H3,(H,20,23)(H,24,25)/b8-3+,13-9+ |
| InChIKey | PWIPPVISROQJBU-FLUXNIISSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cordyceps farinosa (ncbitaxon:89141) | - | PubMed (15568775) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Farinosone C (CHEBI:205334) is a amphetamines (CHEBI:35338) |
| IUPAC Name |
|---|
| (4E,6E)-8-[[1-hydroxy-3-(4-hydroxyphenyl)propan-2-yl]amino]-3,5-dimethyl-8-oxoocta-4,6-dienoic acid |
| Manual Xrefs | Databases |
|---|---|
| 9511905 | ChemSpider |