EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H18O5 |
| Net Charge | 0 |
| Average Mass | 338.359 |
| Monoisotopic Mass | 338.11542 |
| SMILES | COc1cccc2c1C(=O)c1ccc3c(c1C2O)C(=O)C[C@](C)(O)C3 |
| InChI | InChI=1S/C20H18O5/c1-20(24)8-10-6-7-12-17(15(10)13(21)9-20)19(23)11-4-3-5-14(25-2)16(11)18(12)22/h3-7,19,23-24H,8-9H2,1-2H3/t19?,20-/m1/s1 |
| InChIKey | YRKOFHPWOUTOGA-GFOWMXPYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomycesspecies CB01913 (ncbitaxon:1712655) | - | PubMed (26335269) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 12-deoxo-12-hydroxy-8-O-methyltetrangomycin (CHEBI:205292) is a phenanthrol (CHEBI:25962) |
| IUPAC Name |
|---|
| (3R)-3,12-dihydroxy-8-methoxy-3-methyl-4,12-dihydro-2H-benzo[a]anthracene-1,7-dione |
| Manual Xrefs | Databases |
|---|---|
| 58914271 | ChemSpider |