EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H52O12 |
| Net Charge | 0 |
| Average Mass | 676.800 |
| Monoisotopic Mass | 676.34588 |
| SMILES | CCCCCCCCCCCCCCCc1cc(O[C@@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)cc(O)c1C(=O)Oc1cc(C)c(C(=O)O)c(O)c1 |
| InChI | InChI=1S/C36H52O12/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-23-18-25(47-36-33(42)32(41)31(40)28(21-37)48-36)20-27(39)30(23)35(45)46-24-17-22(2)29(34(43)44)26(38)19-24/h17-20,28,31-33,36-42H,3-16,21H2,1-2H3,(H,43,44)/t28-,31+,32+,33-,36-/m1/s1 |
| InChIKey | PAQGKQJWHLLQLF-DIARTVEHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Fusicolla aquaeductuum (ncbitaxon:1053102) | - | PubMed (8270486) |
| Roles Classification |
|---|
| Application: | astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Aquastatin A (CHEBI:205287) is a tannin (CHEBI:26848) |
| IUPAC Name |
|---|
| 2-hydroxy-4-[2-hydroxy-6-pentadecyl-4-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybenzoyl]oxy-6-methylbenzoic acid |
| Manual Xrefs | Databases |
|---|---|
| 167185 | ChemSpider |