EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H40Cl2N2O7 |
| Net Charge | 0 |
| Average Mass | 659.607 |
| Monoisotopic Mass | 658.22126 |
| SMILES | CC(C)C[C@@H]1OC(=O)[C@H](C)CNC(=O)[C@@H](Cc2cc(Cl)c(O)c(Cl)c2)NC(=O)/C=C/C[C@@H]([C@H](C)/C=C/c2ccccc2)OC1=O |
| InChI | InChI=1S/C34H40Cl2N2O7/c1-20(2)15-29-34(43)44-28(21(3)13-14-23-9-6-5-7-10-23)11-8-12-30(39)38-27(32(41)37-19-22(4)33(42)45-29)18-24-16-25(35)31(40)26(36)17-24/h5-10,12-14,16-17,20-22,27-29,40H,11,15,18-19H2,1-4H3,(H,37,41)(H,38,39)/b12-8+,14-13+/t21-,22-,27-,28+,29+/m1/s1 |
| InChIKey | ISTUVLRTAHDXQL-DQHTXJPTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Nostoc (ncbitaxon:1177) | - | DOI (10.1021/ja00154a002) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cryptophycin-45 (CHEBI:205284) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (3S,6R,10R,13E,16S)-10-[(3,5-dichloro-4-hydroxyphenyl)methyl]-6-methyl-3-(2-methylpropyl)-16-[(E,2R)-4-phenylbut-3-en-2-yl]-1,4-dioxa-8,11-diazacyclohexadec-13-ene-2,5,9,12-tetrone |
| Manual Xrefs | Databases |
|---|---|
| 8922239 | ChemSpider |