EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H43N5O7 |
| Net Charge | 0 |
| Average Mass | 645.757 |
| Monoisotopic Mass | 645.31625 |
| SMILES | COn1cc(C[C@@H]2NC(=O)[C@H](CCCCCC(=O)O)NC(=O)[C@H]3CCCCN3C(=O)[C@H](Cc3ccccc3)NC2=O)c2ccccc21 |
| InChI | InChI=1S/C35H43N5O7/c1-47-40-22-24(25-14-8-9-16-29(25)40)21-27-33(44)38-28(20-23-12-4-2-5-13-23)35(46)39-19-11-10-17-30(39)34(45)36-26(32(43)37-27)15-6-3-7-18-31(41)42/h2,4-5,8-9,12-14,16,22,26-28,30H,3,6-7,10-11,15,17-21H2,1H3,(H,36,45)(H,37,43)(H,38,44)(H,41,42)/t26-,27-,28-,30+/m0/s1 |
| InChIKey | NTAHFSRRNUUVIN-VNDOHOEKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Fusarium fujikuroi (ncbitaxon:5127) | - | PubMed (24195442) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Apicidin F (CHEBI:205282) is a oligopeptide (CHEBI:25676) |
| IUPAC Name |
|---|
| 6-[(3S,6S,9S,12R)-3-benzyl-6-[(1-methoxyindol-3-yl)methyl]-2,5,8,11-tetraoxo-1,4,7,10-tetrazabicyclo[10.4.0]hexadecan-9-yl]hexanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 31142541 | ChemSpider |