EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H54N6O9 |
| Net Charge | 0 |
| Average Mass | 690.839 |
| Monoisotopic Mass | 690.39523 |
| SMILES | CC(C)C[C@@H](NC(=O)[C@H](O)Cc1ccccc1)C(=O)N1[C@H](C(=O)NCCCCN=C(N)N)C[C@@H]2CC[C@@H](O[C@H]3OC[C@@H](O)[C@H](O)[C@H]3O)C[C@@H]21 |
| InChI | InChI=1S/C34H54N6O9/c1-19(2)14-23(39-31(46)26(41)15-20-8-4-3-5-9-20)32(47)40-24-17-22(49-33-29(44)28(43)27(42)18-48-33)11-10-21(24)16-25(40)30(45)37-12-6-7-13-38-34(35)36/h3-5,8-9,19,21-29,33,41-44H,6-7,10-18H2,1-2H3,(H,37,45)(H,39,46)(H4,35,36,38)/t21-,22+,23+,24-,25-,26+,27+,28-,29+,33+/m0/s1 |
| InChIKey | JUHSPAYJBZKQRH-IBWPONKNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Planktothrix (ncbitaxon:54304) | - | PubMed (17524987) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Aeruginoside 126B (CHEBI:205274) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| (2S,3aS,6R,7aS)-N-[4-(diaminomethylideneamino)butyl]-1-[(2R)-2-[[(2R)-2-hydroxy-3-phenylpropanoyl]amino]-4-methylpentanoyl]-6-[(2R,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxy-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide |
| Manual Xrefs | Databases |
|---|---|
| 78437260 | ChemSpider |