EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H14O4 |
| Net Charge | 0 |
| Average Mass | 198.218 |
| Monoisotopic Mass | 198.08921 |
| SMILES | CC1=C(C[C@@H](O)CC(=O)O)C(=O)CC1 |
| InChI | InChI=1S/C10H14O4/c1-6-2-3-9(12)8(6)4-7(11)5-10(13)14/h7,11H,2-5H2,1H3,(H,13,14)/t7-/m1/s1 |
| InChIKey | KHOGFVBKFSKLTN-SSDOTTSWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cordyceps cicadae (ncbitaxon:218633) | - | PubMed (18305360) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-(3-carboxy-2-hydroxypropyl)-3-methyl-2-cyclopentenone (CHEBI:205259) is a 3-hydroxy carboxylic acid (CHEBI:61355) |
| IUPAC Name |
|---|
| 3-hydroxy-4-(2-methyl-5-oxocyclopenten-1-yl)butanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 28285007 | ChemSpider |