EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H22N2O4 |
| Net Charge | 0 |
| Average Mass | 378.428 |
| Monoisotopic Mass | 378.15796 |
| SMILES | COC(CO)[C@@H](c1nc2ccccc2c1CC(=O)O)c1cnc2ccccc12 |
| InChI | InChI=1S/C22H22N2O4/c1-28-19(12-25)21(16-11-23-17-8-4-2-7-14(16)17)22-15(10-20(26)27)13-6-3-5-9-18(13)24-22/h2-9,11,19,21,23-25H,10,12H2,1H3,(H,26,27)/t19?,21-/m0/s1 |
| InChIKey | MQRYPXXPMWCWNO-QWAKEFERSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rubrobacter radiotolerans (ncbitaxon:42256) | - | PubMed (25655350) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-(2-(3-hydroxy-1-(1H-indol-3-yl)-2-methoxypropyl)-1H-indol-3-yl) acetic acid (CHEBI:205233) is a indole-3-acetic acids (CHEBI:24803) |
| IUPAC Name |
|---|
| 2-[2-[(1R)-3-hydroxy-1-(1H-indol-3-yl)-2-methoxypropyl]-1H-indol-3-yl]acetic acid |
| Manual Xrefs | Databases |
|---|---|
| 35516896 | ChemSpider |