EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H15NO3 |
| Net Charge | 0 |
| Average Mass | 197.234 |
| Monoisotopic Mass | 197.10519 |
| SMILES | CC(C=CC(N)=O)=C[C@H](C)CC(=O)O |
| InChI | InChI=1S/C10H15NO3/c1-7(3-4-9(11)12)5-8(2)6-10(13)14/h3-5,8H,6H2,1-2H3,(H2,11,12)(H,13,14)/t8-/m0/s1 |
| InChIKey | IMOQARKVTAXVLY-QMMMGPOBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Gymnascella dankaliensis (ncbitaxon:166389) | - | PubMed (25600409) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Dankamide (CHEBI:205196) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| (3R)-8-amino-3,5-dimethyl-8-oxoocta-4,6-dienoic acid |