EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H46O5 |
| Net Charge | 0 |
| Average Mass | 498.704 |
| Monoisotopic Mass | 498.33452 |
| SMILES | C=C(CC[C@@H](C(=O)O)[C@H]1[C@H](O)C[C@@]2(C)C3=CC[C@H]4[C@@](C)(CO)C(=O)CC[C@]4(C)C3=CC[C@]12C)C(C)C |
| InChI | InChI=1S/C31H46O5/c1-18(2)19(3)8-9-20(27(35)36)26-23(33)16-31(7)22-10-11-24-28(4,21(22)12-15-30(26,31)6)14-13-25(34)29(24,5)17-32/h10,12,18,20,23-24,26,32-33H,3,8-9,11,13-17H2,1-2,4-7H3,(H,35,36)/t20-,23-,24-,26+,28-,29-,30-,31+/m1/s1 |
| InChIKey | WMGIVNDVJFWFEU-ROUXZGEUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Wolfiporia cocos (ncbitaxon:81056) | - | PubMed (18827390) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 29-hydroxypolyporenic acid C (CHEBI:205193) is a bile acid (CHEBI:3098) |
| IUPAC Name |
|---|
| (2R)-2-[(4S,5R,10S,13R,14R,16R,17R)-16-hydroxy-4-(hydroxymethyl)-4,10,13,14-tetramethyl-3-oxo-1,2,5,6,12,15,16,17-octahydrocyclopenta[a]phenanthren-17-yl]-6-methyl-5-methylideneheptanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78441042 | ChemSpider |