EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H33ClO5 |
| Net Charge | 0 |
| Average Mass | 460.998 |
| Monoisotopic Mass | 460.20165 |
| SMILES | CC(C)=CCCC(C)=CCC(C[C@]1(O)C(=O)c2cc(O)cc(O)c2C(=O)[C@]1(C)Cl)=C(C)C |
| InChI | InChI=1S/C26H33ClO5/c1-15(2)8-7-9-17(5)10-11-18(16(3)4)14-26(32)23(30)20-12-19(28)13-21(29)22(20)24(31)25(26,6)27/h8,10,12-13,28-29,32H,7,9,11,14H2,1-6H3/t25-,26-/m0/s1 |
| InChIKey | UUMRLFAHEFYGJM-UIOOFZCWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (22784372) |
| Roles Classification |
|---|
| Biological Roles: | fat-soluble vitamin (role) Any vitamin that dissolves in fats and are stored in body tissues. Unlike the water-soluble vitamins, they are stored in the body for long periods of time and generally pose a greater risk for toxicity when consumed in excess. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Merochlorin D (CHEBI:205165) is a vitamin K (CHEBI:28384) |
| IUPAC Name |
|---|
| (2S,3R)-3-chloro-2-(5,9-dimethyl-2-propan-2-ylidenedeca-4,8-dienyl)-2,5,7-trihydroxy-3-methylnaphthalene-1,4-dione |