EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H21NO2 |
| Net Charge | 0 |
| Average Mass | 235.327 |
| Monoisotopic Mass | 235.15723 |
| SMILES | CCCCC[C@H](C)COC(=O)c1ccncc1 |
| InChI | InChI=1S/C14H21NO2/c1-3-4-5-6-12(2)11-17-14(16)13-7-9-15-10-8-13/h7-10,12H,3-6,11H2,1-2H3/t12-/m0/s1 |
| InChIKey | SJGJCJLSSXJWOR-LBPRGKRZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomycesspecies (ncbitaxon:1931) | - | DOI (10.1271/bbb.65.1856) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-methyl-heptyl isonicotinate (CHEBI:205163) is a aromatic carboxylic acid (CHEBI:33859) |
| 2-methyl-heptyl isonicotinate (CHEBI:205163) is a pyridines (CHEBI:26421) |
| IUPAC Name |
|---|
| [(2S)-2-methylheptyl] pyridine-4-carboxylate |
| Manual Xrefs | Databases |
|---|---|
| 24823967 | ChemSpider |