EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H22N2O2 |
| Net Charge | 0 |
| Average Mass | 346.430 |
| Monoisotopic Mass | 346.16813 |
| SMILES | CC(C)CC(C(=O)O)(c1cnc2ccccc12)c1cnc2ccccc12 |
| InChI | InChI=1S/C22H22N2O2/c1-14(2)11-22(21(25)26,17-12-23-19-9-5-3-7-15(17)19)18-13-24-20-10-6-4-8-16(18)20/h3-10,12-14,23-24H,11H2,1-2H3,(H,25,26) |
| InChIKey | WVXVAVCGGZLUNU-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (10843566) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,2-bis(3,3'-indolyl)-isocaproic acid (CHEBI:205144) is a indole-3-acetic acids (CHEBI:24803) |
| IUPAC Name |
|---|
| 2,2-bis(1H-indol-3-yl)-4-methylpentanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 8816681 | ChemSpider |