EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H8O5 |
| Net Charge | 0 |
| Average Mass | 196.158 |
| Monoisotopic Mass | 196.03717 |
| SMILES | Cc1c(O)cc(O)c(C=O)c1C(=O)O |
| InChI | InChI=1S/C9H8O5/c1-4-6(11)2-7(12)5(3-10)8(4)9(13)14/h2-3,11-12H,1H3,(H,13,14) |
| InChIKey | GFCKLXYGLFKTDL-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Talaromyces ruber (ncbitaxon:1266769) | - | DOI (10.1007/s10600-008-9094-z) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-formyl-3,5-dihydroxy-6-methylbenzoic acid (CHEBI:205116) is a hydroxybenzoic acid (CHEBI:24676) |
| IUPAC Name |
|---|
| 2-ormyl-3,5-dihydroxy-6-methylbenzoic acid |
| Manual Xrefs | Databases |
|---|---|
| 27023446 | ChemSpider |