EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H21N3O4 |
| Net Charge | 0 |
| Average Mass | 355.394 |
| Monoisotopic Mass | 355.15321 |
| SMILES | C=CC(C)(C)c1nc2ccccc2c1/C=C(\NC(=O)C(N)=O)C(=O)OC |
| InChI | InChI=1S/C19H21N3O4/c1-5-19(2,3)15-12(11-8-6-7-9-13(11)21-15)10-14(18(25)26-4)22-17(24)16(20)23/h5-10,21H,1H2,2-4H3,(H2,20,23)(H,22,24)/b14-10- |
| InChIKey | WMAYXXXLOKRQKS-UVTDQMKNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Eurotium (ncbitaxon:28569) | - | PubMed (22727636) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cristatumin D (CHEBI:205101) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| methyl (Z)-3-[2-(2-methylbut-3-en-2-yl)-1H-indol-3-yl]-2-(oxamoylamino)prop-2-enoate |
| Manual Xrefs | Databases |
|---|---|
| 28505170 | ChemSpider |