EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H32N4O11 |
| Net Charge | 0 |
| Average Mass | 588.570 |
| Monoisotopic Mass | 588.20676 |
| SMILES | CC(=O)N(O)CCCCNC(=O)[C@H](COC(=O)c1cccc(O)c1O)NC(=O)[C@H]1N=C(c2cccc(O)c2O)O[C@@H]1C |
| InChI | InChI=1S/C27H32N4O11/c1-14-21(30-26(42-14)16-7-5-9-19(33)22(16)35)25(38)29-18(24(37)28-11-3-4-12-31(40)15(2)32)13-41-27(39)17-8-6-10-20(34)23(17)36/h5-10,14,18,21,33-36,40H,3-4,11-13H2,1-2H3,(H,28,37)(H,29,38)/t14-,18+,21+/m1/s1 |
| InChIKey | UEUUKYCTOZDARB-IBZMOEQTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Acinetobacter baumannii ATCC 17978 (ncbitaxon:400667) | - | PubMed (23456955) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Fimsbactin B (CHEBI:205088) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| [(2S)-3-[4-[acetyl(hydroxy)amino]butylamino]-2-[[(4S,5R)-2-(2,3-dihydroxyphenyl)-5-methyl-4,5-dihydro-1,3-oxazole-4-carbonyl]amino]-3-oxopropyl] 2,3-dihydroxybenzoate |
| Manual Xrefs | Databases |
|---|---|
| 78440211 | ChemSpider |