EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H27NO9 |
| Net Charge | 0 |
| Average Mass | 473.478 |
| Monoisotopic Mass | 473.16858 |
| SMILES | C[C@H]1O[C@@H]2CC(=O)O[C@@H]2C2=C1C(=O)c1c(ccc([C@H]3C[C@@H]([N+](C)(C)[O-])[C@H](O)[C@@H](C)O3)c1O)C2=O |
| InChI | InChI=1S/C24H27NO9/c1-9-17-19(24-15(32-9)8-16(26)34-24)22(29)12-6-5-11(21(28)18(12)23(17)30)14-7-13(25(3,4)31)20(27)10(2)33-14/h5-6,9-10,13-15,20,24,27-28H,7-8H2,1-4H3/t9-,10-,13-,14-,15-,20-,24+/m1/s1 |
| InChIKey | ABNGXYJNUFFHCJ-CNRHASOASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (8002402) |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Menoxymycin A (CHEBI:205036) is a benzoisochromanequinone (CHEBI:48129) |
| IUPAC Name |
|---|
| (2R,3S,4R,6R)-3-hydroxy-6-[(11R,15R,17R)-4-hydroxy-17-methyl-2,9,13-trioxo-12,16-dioxatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),3(8),4,6-tetraen-5-yl]-N,N,2-trimethyloxan-4-amine oxide |
| Manual Xrefs | Databases |
|---|---|
| 8632973 | ChemSpider |